C20H15NO2 — CID 158195775
(4S,5S)-3-methylidene-4-phenyl-5-quinolin-4-yloxolan-2-one (PubChem CID 158195775) has the molecular formula C20H15NO2 and a molecular weight of 301.35 g/mol. Its IUPAC name is (4S,5S)-3-methylidene-4-phenyl-5-quinolin-4-yloxolan-2-one.
| Compound Name | (4S,5S)-3-methylidene-4-phenyl-5-quinolin-4-yloxolan-2-one |
|---|---|
| PubChem CID | 158195775 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (4S,5S)-3-methylidene-4-phenyl-5-quinolin-4-yloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](c2ccnc3ccccc23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H15NO2/c1-13-18(14-7-3-2-4-8-14)19(23-20(13)22)16-11-12-21-17-10-6-5-9-15(16)17/h2-12,18-19H,1H2/t18-,19-/m1/s1 |
| InChIKey | GAIABGSNMDJCJE-RTBURBONSA-N |
| XLogP | 4.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|