C11H14N2O2 — CID 67780354
1-(1,3-benzodioxol-2-yl)piperazine (PubChem CID 67780354) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-2-yl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-2-yl)piperazine |
|---|---|
| PubChem CID | 67780354 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(1,3-benzodioxol-2-yl)piperazine |
| SMILES | c1ccc2c(c1)OC(N1CCNCC1)O2 |
| InChI | InChI=1S/C11H14N2O2/c1-2-4-10-9(3-1)14-11(15-10)13-7-5-12-6-8-13/h1-4,11-12H,5-8H2 |
| InChIKey | KFABMKXVVOZJHZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |