C11H13NO2 — CID 144586760
2-(1,3-benzodioxol-2-yl)pyrrolidine (PubChem CID 144586760) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-2-yl)pyrrolidine.
| Compound Name | 2-(1,3-benzodioxol-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 144586760 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-(1,3-benzodioxol-2-yl)pyrrolidine |
| SMILES | c1ccc2c(c1)OC(C1CCCN1)O2 |
| InChI | InChI=1S/C11H13NO2/c1-2-6-10-9(5-1)13-11(14-10)8-4-3-7-12-8/h1-2,5-6,8,11-12H,3-4,7H2 |
| InChIKey | APUUZIODEWLMFA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |