About 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine
2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine (PubChem CID 115062678) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine.
Molecular Properties
| Compound Name | 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine |
| PubChem CID | 115062678 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine |
| SMILES | Brc1ccc2c(c1)COC(C1CCCCN1)O2 |
| InChI | InChI=1S/C13H16BrNO2/c14-10-4-5-12-9(7-10)8-16-13(17-12)11-3-1-2-6-15-11/h4-5,7,11,13,15H,1-3,6,8H2 |
| InChIKey | BZJVCWFAYOUDEU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine?
The IUPAC name of 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine (CID 115062678) is 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine.
What is the SMILES notation for 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine?
The canonical SMILES for 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine is Brc1ccc2c(c1)COC(C1CCCCN1)O2.
What is the InChIKey of 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine?
The InChIKey is BZJVCWFAYOUDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c14-10-4-5-12-9(7-10)8-16-13(17-12)11-3-1-2-6-15-11/h4-5,7,11,13,15H,1-3,6,8H2.
What are the key properties of 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine?
2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine has a molecular weight of 298.18 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-4H-1,3-benzodioxin-2-yl)piperidine is sourced from PubChem (CID 115062678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).