C11H8O2 — CID 54077713
3H-benzo[g][1,2]benzodioxole (PubChem CID 54077713) has the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3H-benzo[g][1,2]benzodioxole.
| Compound Name | 3H-benzo[g][1,2]benzodioxole |
|---|---|
| PubChem CID | 54077713 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 3H-benzo[g][1,2]benzodioxole |
| SMILES | c1ccc2c3c(ccc2c1)COO3 |
| InChI | InChI=1S/C11H8O2/c1-2-4-10-8(3-1)5-6-9-7-12-13-11(9)10/h1-6H,7H2 |
| InChIKey | QLBBRASMEYARKU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|