C19H16O — CID 15828390
2-phenyl-3,4-dihydro-2H-benzo[h]chromene (PubChem CID 15828390) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-2H-benzo[h]chromene.
| Compound Name | 2-phenyl-3,4-dihydro-2H-benzo[h]chromene |
|---|---|
| PubChem CID | 15828390 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-phenyl-3,4-dihydro-2H-benzo[h]chromene |
| SMILES | c1ccc(C2CCc3ccc4ccccc4c3O2)cc1 |
| InChI | InChI=1S/C19H16O/c1-2-7-15(8-3-1)18-13-12-16-11-10-14-6-4-5-9-17(14)19(16)20-18/h1-11,18H,12-13H2 |
| InChIKey | OBEHUHNHMOLTIP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |