C14H12S — CID 10632343
14-thiatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene (PubChem CID 10632343) has the molecular formula C14H12S and a molecular weight of 212.32 g/mol. Its IUPAC name is 14-thiatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene.
| Compound Name | 14-thiatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 10632343 |
| Molecular Formula | C14H12S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 14-thiatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene |
| SMILES | c1ccc2c3c(ccc2c1)CCC1SC31 |
| InChI | InChI=1S/C14H12S/c1-2-4-11-9(3-1)5-6-10-7-8-12-14(15-12)13(10)11/h1-6,12,14H,7-8H2 |
| InChIKey | MBIWQCBPPKDOLV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|