C30H30 — CID 98518751
(3R,4R)-4-methyl-3-[[(4S)-1,2,3,4-tetrahydrophenanthren-4-yl]methyl]-1,2,3,4-tetrahydrophenanthrene (PubChem CID 98518751) has the molecular formula C30H30 and a molecular weight of 390.57 g/mol. Its IUPAC name is (3R,4R)-4-methyl-3-[[(4S)-1,2,3,4-tetrahydrophenanthren-4-yl]methyl]-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | (3R,4R)-4-methyl-3-[[(4S)-1,2,3,4-tetrahydrophenanthren-4-yl]methyl]-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 98518751 |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (3R,4R)-4-methyl-3-[[(4S)-1,2,3,4-tetrahydrophenanthren-4-yl]methyl]-1,2,3,4-tetrahydrophenanthrene |
| SMILES | C[C@H]1c2c(ccc3ccccc23)CC[C@@H]1C[C@@H]1CCCc2ccc3ccccc3c21 |
| InChI | InChI=1S/C30H30/c1-20-25(18-17-24-16-14-21-7-2-4-11-27(21)29(20)24)19-26-10-6-9-23-15-13-22-8-3-5-12-28(22)30(23)26/h2-5,7-8,11-16,20,25-26H,6,9-10,17-19H2,1H3/t20-,25-,26+/m1/s1 |
| InChIKey | PCQOPYQWOJOSGA-VANUSSGQSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |