C17H18O3 — CID 141011089
2-(6-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetic acid (PubChem CID 141011089) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(6-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetic acid.
| Compound Name | 2-(6-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetic acid |
|---|---|
| PubChem CID | 141011089 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(6-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetic acid |
| SMILES | COc1ccc2ccc3c(c2c1)C(CC(=O)O)CCC3 |
| InChI | InChI=1S/C17H18O3/c1-20-14-8-7-11-5-6-12-3-2-4-13(9-16(18)19)17(12)15(11)10-14/h5-8,10,13H,2-4,9H2,1H3,(H,18,19) |
| InChIKey | ZUTBDQXYWKIZJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |