C17H21NO3 — CID 101347837
methyl 2-(6-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)acetate (PubChem CID 101347837) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 2-(6-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)acetate.
| Compound Name | methyl 2-(6-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)acetate |
|---|---|
| PubChem CID | 101347837 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl 2-(6-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)acetate |
| SMILES | COC(=O)CC1CCCc2c1c1cc(OC)ccc1n2C |
| InChI | InChI=1S/C17H21NO3/c1-18-14-8-7-12(20-2)10-13(14)17-11(9-16(19)21-3)5-4-6-15(17)18/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | ZEFWCKKFNMFTJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|