C16H22N2O — CID 10563187
(2-methoxy-5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-10-yl)methanamine (PubChem CID 10563187) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (2-methoxy-5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-10-yl)methanamine.
| Compound Name | (2-methoxy-5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-10-yl)methanamine |
|---|---|
| PubChem CID | 10563187 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2-methoxy-5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-10-yl)methanamine |
| SMILES | COc1ccc2c(c1)c1c(n2C)CCCCC1CN |
| InChI | InChI=1S/C16H22N2O/c1-18-14-8-7-12(19-2)9-13(14)16-11(10-17)5-3-4-6-15(16)18/h7-9,11H,3-6,10,17H2,1-2H3 |
| InChIKey | GKMWGKLLDCYNDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|