C18H24N2O — CID 69419460
6-methoxy-4-(1-methylpiperidin-4-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indole (PubChem CID 69419460) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-methoxy-4-(1-methylpiperidin-4-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
| Compound Name | 6-methoxy-4-(1-methylpiperidin-4-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
|---|---|
| PubChem CID | 69419460 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 6-methoxy-4-(1-methylpiperidin-4-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| SMILES | COc1ccc2c(c1)c(C1CCN(C)CC1)c1n2CCC1 |
| InChI | InChI=1S/C18H24N2O/c1-19-10-7-13(8-11-19)18-15-12-14(21-2)5-6-16(15)20-9-3-4-17(18)20/h5-6,12-13H,3-4,7-11H2,1-2H3 |
| InChIKey | XFABVMNMRDQKDJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|