C14H16N2O2 — CID 102568775
methyl 7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-1-carboxylate (PubChem CID 102568775) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-1-carboxylate.
| Compound Name | methyl 7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-1-carboxylate |
|---|---|
| PubChem CID | 102568775 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | methyl 7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-1-carboxylate |
| SMILES | COC(=O)C1CCc2c1c1cc(N)ccc1n2C |
| InChI | InChI=1S/C14H16N2O2/c1-16-11-5-3-8(15)7-10(11)13-9(14(17)18-2)4-6-12(13)16/h3,5,7,9H,4,6,15H2,1-2H3 |
| InChIKey | ASWVJPIDTXVGCD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|