C14H16N2O2 — CID 167211372
9-amino-1,6-dimethyl-2,3-dihydro-1H-pyrano[2,3-c]quinolin-5-one (PubChem CID 167211372) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 9-amino-1,6-dimethyl-2,3-dihydro-1H-pyrano[2,3-c]quinolin-5-one.
| Compound Name | 9-amino-1,6-dimethyl-2,3-dihydro-1H-pyrano[2,3-c]quinolin-5-one |
|---|---|
| PubChem CID | 167211372 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 9-amino-1,6-dimethyl-2,3-dihydro-1H-pyrano[2,3-c]quinolin-5-one |
| SMILES | CC1CCOc2c1c1cc(N)ccc1n(C)c2=O |
| InChI | InChI=1S/C14H16N2O2/c1-8-5-6-18-13-12(8)10-7-9(15)3-4-11(10)16(2)14(13)17/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | CCMHYBGEYKNRRL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|