C11H13N3O2 — CID 82372186
6-amino-1-ethyl-3-methylquinazoline-2,4-dione (PubChem CID 82372186) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-amino-1-ethyl-3-methylquinazoline-2,4-dione.
| Compound Name | 6-amino-1-ethyl-3-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 82372186 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-amino-1-ethyl-3-methylquinazoline-2,4-dione |
| SMILES | CCn1c(=O)n(C)c(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C11H13N3O2/c1-3-14-9-5-4-7(12)6-8(9)10(15)13(2)11(14)16/h4-6H,3,12H2,1-2H3 |
| InChIKey | UEBBIHDFAQFOEH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|