C28H27N5 — CID 159856666
anthracene-9,10-diamine;9-ethylcarbazole-3,6-diamine (PubChem CID 159856666) has the molecular formula C28H27N5 and a molecular weight of 433.56 g/mol. Its IUPAC name is anthracene-9,10-diamine;9-ethylcarbazole-3,6-diamine.
| Compound Name | anthracene-9,10-diamine;9-ethylcarbazole-3,6-diamine |
|---|---|
| PubChem CID | 159856666 |
| Molecular Formula | C28H27N5 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | anthracene-9,10-diamine;9-ethylcarbazole-3,6-diamine |
| SMILES | CCn1c2ccc(N)cc2c2cc(N)ccc21.Nc1c2ccccc2c(N)c2ccccc12 |
| InChI | InChI=1S/C14H15N3.C14H12N2/c1-2-17-13-5-3-9(15)7-11(13)12-8-10(16)4-6-14(12)17;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h3-8H,2,15-16H2,1H3;1-8H,15-16H2 |
| InChIKey | NQPRFHYRAOCRFZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|