C24H23N3 — CID 175329016
9-ethylcarbazole;naphthalene-1,3-diamine (PubChem CID 175329016) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 9-ethylcarbazole;naphthalene-1,3-diamine.
| Compound Name | 9-ethylcarbazole;naphthalene-1,3-diamine |
|---|---|
| PubChem CID | 175329016 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 9-ethylcarbazole;naphthalene-1,3-diamine |
| SMILES | CCn1c2ccccc2c2ccccc21.Nc1cc(N)c2ccccc2c1 |
| InChI | InChI=1S/C14H13N.C10H10N2/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;11-8-5-7-3-1-2-4-9(7)10(12)6-8/h3-10H,2H2,1H3;1-6H,11-12H2 |
| InChIKey | XXQWFVKCTHNZLQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|