About 9-ethylcarbazol-3-amine;naphthalen-1-amine
9-ethylcarbazol-3-amine;naphthalen-1-amine (PubChem CID 66872678) has the molecular formula C24H23N3
and a molecular weight of 353.47 g/mol. Its IUPAC name is 9-ethylcarbazol-3-amine;naphthalen-1-amine.
Molecular Properties
| Compound Name | 9-ethylcarbazol-3-amine;naphthalen-1-amine |
| PubChem CID | 66872678 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 9-ethylcarbazol-3-amine;naphthalen-1-amine |
| SMILES | CCn1c2ccccc2c2cc(N)ccc21.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14N2.C10H9N/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;11-10-7-3-5-8-4-1-2-6-9(8)10/h3-9H,2,15H2,1H3;1-7H,11H2 |
| InChIKey | FJZQKAHXJNKAGA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-ethylcarbazol-3-amine;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylcarbazol-3-amine;naphthalen-1-amine?
The IUPAC name of 9-ethylcarbazol-3-amine;naphthalen-1-amine (CID 66872678) is 9-ethylcarbazol-3-amine;naphthalen-1-amine.
What is the SMILES notation for 9-ethylcarbazol-3-amine;naphthalen-1-amine?
The canonical SMILES for 9-ethylcarbazol-3-amine;naphthalen-1-amine is CCn1c2ccccc2c2cc(N)ccc21.Nc1cccc2ccccc12.
What is the InChIKey of 9-ethylcarbazol-3-amine;naphthalen-1-amine?
The InChIKey is FJZQKAHXJNKAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C10H9N/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;11-10-7-3-5-8-4-1-2-6-9(8)10/h3-9H,2,15H2,1H3;1-7H,11H2.
What are the key properties of 9-ethylcarbazol-3-amine;naphthalen-1-amine?
9-ethylcarbazol-3-amine;naphthalen-1-amine has a molecular weight of 353.47 g/mol, XLogP of 5.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylcarbazol-3-amine;naphthalen-1-amine is sourced from PubChem (CID 66872678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).