C13H15N3O2 — CID 146189034
10-amino-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one (PubChem CID 146189034) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 10-amino-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one.
| Compound Name | 10-amino-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 146189034 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 10-amino-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one |
| SMILES | Cn1c(=O)c2c(c3cc(N)ccc31)NCCCO2 |
| InChI | InChI=1S/C13H15N3O2/c1-16-10-4-3-8(14)7-9(10)11-12(13(16)17)18-6-2-5-15-11/h3-4,7,15H,2,5-6,14H2,1H3 |
| InChIKey | ZSTRGEITPLDUAT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|