C16H19N3O2 — CID 146189000
9-amino-2-cyclobutyl-6-methyl-2,3-dihydro-1H-[1,4]oxazino[2,3-c]quinolin-5-one (PubChem CID 146189000) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 9-amino-2-cyclobutyl-6-methyl-2,3-dihydro-1H-[1,4]oxazino[2,3-c]quinolin-5-one.
| Compound Name | 9-amino-2-cyclobutyl-6-methyl-2,3-dihydro-1H-[1,4]oxazino[2,3-c]quinolin-5-one |
|---|---|
| PubChem CID | 146189000 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 9-amino-2-cyclobutyl-6-methyl-2,3-dihydro-1H-[1,4]oxazino[2,3-c]quinolin-5-one |
| SMILES | Cn1c(=O)c2c(c3cc(N)ccc31)NC(C1CCC1)CO2 |
| InChI | InChI=1S/C16H19N3O2/c1-19-13-6-5-10(17)7-11(13)14-15(16(19)20)21-8-12(18-14)9-3-2-4-9/h5-7,9,12,18H,2-4,8,17H2,1H3 |
| InChIKey | PDNDDLOCBFKSHP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|