C21H20Cl2N4O2 — CID 146191441
(2R)-2-cyclopropyl-10-[(2,3-dichloro-4-pyridinyl)amino]-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one (PubChem CID 146191441) has the molecular formula C21H20Cl2N4O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is (2R)-2-cyclopropyl-10-[(2,3-dichloro-4-pyridinyl)amino]-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one.
| Compound Name | (2R)-2-cyclopropyl-10-[(2,3-dichloro-4-pyridinyl)amino]-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 146191441 |
| Molecular Formula | C21H20Cl2N4O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (2R)-2-cyclopropyl-10-[(2,3-dichloro-4-pyridinyl)amino]-7-methyl-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-6-one |
| SMILES | Cn1c(=O)c2c(c3cc(Nc4ccnc(Cl)c4Cl)ccc31)N[C@@H](C1CC1)CCO2 |
| InChI | InChI=1S/C21H20Cl2N4O2/c1-27-16-5-4-12(25-15-6-8-24-20(23)17(15)22)10-13(16)18-19(21(27)28)29-9-7-14(26-18)11-2-3-11/h4-6,8,10-11,14,26H,2-3,7,9H2,1H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | VGGMRKDZUASPTK-CQSZACIVSA-N |
| XLogP | 4.96 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|