C27H30ClF2N5O3 — CID 156726841
(2S)-10-[[5-chloro-2-[(5S)-3-hydroxy-5-methylpiperidin-1-yl]-4-pyridinyl]amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one (PubChem CID 156726841) has the molecular formula C27H30ClF2N5O3 and a molecular weight of 546.02 g/mol. Its IUPAC name is (2S)-10-[[5-chloro-2-[(5S)-3-hydroxy-5-methylpiperidin-1-yl]-4-pyridinyl]amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one.
| Compound Name | (2S)-10-[[5-chloro-2-[(5S)-3-hydroxy-5-methylpiperidin-1-yl]-4-pyridinyl]amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 156726841 |
| Molecular Formula | C27H30ClF2N5O3 |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (2S)-10-[[5-chloro-2-[(5S)-3-hydroxy-5-methylpiperidin-1-yl]-4-pyridinyl]amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
| SMILES | C[C@H]1CC(O)CN(c2cc(Nc3ccc4c(c3)c3c(c(=O)n4C)OCC(F)(F)[C@H](C4CC4)N3)c(Cl)cn2)C1 |
| InChI | InChI=1S/C27H30ClF2N5O3/c1-14-7-17(36)12-35(11-14)22-9-20(19(28)10-31-22)32-16-5-6-21-18(8-16)23-24(26(37)34(21)2)38-13-27(29,30)25(33-23)15-3-4-15/h5-6,8-10,14-15,17,25,33,36H,3-4,7,11-13H2,1-2H3,(H,31,32)/t14-,17?,25-/m0/s1 |
| InChIKey | ZGMZUSHURIOBHU-XAUNMNBISA-N |
| XLogP | 4.76 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |