C22H17Cl2F2N5O2 — CID 167458424
2,5-dichloro-6-[[(2S)-2-cyclopropyl-3,3-difluoro-7-methyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl]amino]pyridine-3-carbonitrile (PubChem CID 167458424) has the molecular formula C22H17Cl2F2N5O2 and a molecular weight of 492.31 g/mol. Its IUPAC name is 2,5-dichloro-6-[[(2S)-2-cyclopropyl-3,3-difluoro-7-methyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2,5-dichloro-6-[[(2S)-2-cyclopropyl-3,3-difluoro-7-methyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167458424 |
| Molecular Formula | C22H17Cl2F2N5O2 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 2,5-dichloro-6-[[(2S)-2-cyclopropyl-3,3-difluoro-7-methyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl]amino]pyridine-3-carbonitrile |
| SMILES | Cn1c(=O)c2c(c3cc(Nc4nc(Cl)c(C#N)cc4Cl)ccc31)N[C@@H](C1CC1)C(F)(F)CO2 |
| InChI | InChI=1S/C22H17Cl2F2N5O2/c1-31-15-5-4-12(28-20-14(23)6-11(8-27)19(24)30-20)7-13(15)16-17(21(31)32)33-9-22(25,26)18(29-16)10-2-3-10/h4-7,10,18,29H,2-3,9H2,1H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | AXKRQGJTCNRKQG-SFHVURJKSA-N |
| XLogP | 5.07 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|