C20H20OS — CID 15285058
15-ethylsulfanyl-2-methoxy-16,17-dihydro-15H-cyclopenta[a]phenanthrene (PubChem CID 15285058) has the molecular formula C20H20OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 15-ethylsulfanyl-2-methoxy-16,17-dihydro-15H-cyclopenta[a]phenanthrene.
| Compound Name | 15-ethylsulfanyl-2-methoxy-16,17-dihydro-15H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 15285058 |
| Molecular Formula | C20H20OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 15-ethylsulfanyl-2-methoxy-16,17-dihydro-15H-cyclopenta[a]phenanthrene |
| SMILES | CCSC1CCc2ccc3c(ccc4ccc(OC)cc43)c21 |
| InChI | InChI=1S/C20H20OS/c1-3-22-19-11-7-14-6-9-16-17(20(14)19)10-5-13-4-8-15(21-2)12-18(13)16/h4-6,8-10,12,19H,3,7,11H2,1-2H3 |
| InChIKey | QQXOHCQVECNNRC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|