C24H26N2 — CID 174813719
2H-pyrrole;2-(1,2,3,4-tetrahydrochrysen-4-yl)ethanamine (PubChem CID 174813719) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2H-pyrrole;2-(1,2,3,4-tetrahydrochrysen-4-yl)ethanamine.
| Compound Name | 2H-pyrrole;2-(1,2,3,4-tetrahydrochrysen-4-yl)ethanamine |
|---|---|
| PubChem CID | 174813719 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2H-pyrrole;2-(1,2,3,4-tetrahydrochrysen-4-yl)ethanamine |
| SMILES | C1=CCN=C1.NCCC1CCCc2ccc3c(ccc4ccccc43)c21 |
| InChI | InChI=1S/C20H21N.C4H5N/c21-13-12-16-6-3-5-15-9-10-18-17-7-2-1-4-14(17)8-11-19(18)20(15)16;1-2-4-5-3-1/h1-2,4,7-11,16H,3,5-6,12-13,21H2;1-3H,4H2 |
| InChIKey | ACVWBVADAIGSAR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|