C23H23NS — CID 174606924
1,2,3,4-tetrahydrochrysen-4-amine;2H-thiopyran (PubChem CID 174606924) has the molecular formula C23H23NS and a molecular weight of 345.51 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochrysen-4-amine;2H-thiopyran.
| Compound Name | 1,2,3,4-tetrahydrochrysen-4-amine;2H-thiopyran |
|---|---|
| PubChem CID | 174606924 |
| Molecular Formula | C23H23NS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1,2,3,4-tetrahydrochrysen-4-amine;2H-thiopyran |
| SMILES | C1=CCSC=C1.NC1CCCc2ccc3c(ccc4ccccc43)c21 |
| InChI | InChI=1S/C18H17N.C5H6S/c19-17-7-3-5-13-9-10-15-14-6-2-1-4-12(14)8-11-16(15)18(13)17;1-2-4-6-5-3-1/h1-2,4,6,8-11,17H,3,5,7,19H2;1-4H,5H2 |
| InChIKey | VMHABBLNIJWEDF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|