About 1-hydroxy-3H-benzo[g][2,1]benzoxaborole
1-hydroxy-3H-benzo[g][2,1]benzoxaborole (PubChem CID 11846118) has the molecular formula C11H9BO2
and a molecular weight of 184.00 g/mol. Its IUPAC name is 1-hydroxy-3H-benzo[g][2,1]benzoxaborole.
Molecular Properties
| Compound Name | 1-hydroxy-3H-benzo[g][2,1]benzoxaborole |
| PubChem CID | 11846118 |
| Molecular Formula | C11H9BO2 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-hydroxy-3H-benzo[g][2,1]benzoxaborole |
| SMILES | OB1OCc2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H9BO2/c13-12-11-9(7-14-12)6-5-8-3-1-2-4-10(8)11/h1-6,13H,7H2 |
| InChIKey | RKVSRXYPRHUVSI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3H-benzo[g][2,1]benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3H-benzo[g][2,1]benzoxaborole?
The IUPAC name of 1-hydroxy-3H-benzo[g][2,1]benzoxaborole (CID 11846118) is 1-hydroxy-3H-benzo[g][2,1]benzoxaborole.
What is the SMILES notation for 1-hydroxy-3H-benzo[g][2,1]benzoxaborole?
The canonical SMILES for 1-hydroxy-3H-benzo[g][2,1]benzoxaborole is OB1OCc2ccc3ccccc3c21.
What is the InChIKey of 1-hydroxy-3H-benzo[g][2,1]benzoxaborole?
The InChIKey is RKVSRXYPRHUVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BO2/c13-12-11-9(7-14-12)6-5-8-3-1-2-4-10(8)11/h1-6,13H,7H2.
What are the key properties of 1-hydroxy-3H-benzo[g][2,1]benzoxaborole?
1-hydroxy-3H-benzo[g][2,1]benzoxaborole has a molecular weight of 184.00 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3H-benzo[g][2,1]benzoxaborole is sourced from PubChem (CID 11846118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).