C11H9BO2 — CID 11846118
1-hydroxy-3H-benzo[g][2,1]benzoxaborole (PubChem CID 11846118) has the molecular formula C11H9BO2 and a molecular weight of 184.00 g/mol. Its IUPAC name is 1-hydroxy-3H-benzo[g][2,1]benzoxaborole.
| Compound Name | 1-hydroxy-3H-benzo[g][2,1]benzoxaborole |
|---|---|
| PubChem CID | 11846118 |
| Molecular Formula | C11H9BO2 |
| Molecular Weight | 184.00 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-hydroxy-3H-benzo[g][2,1]benzoxaborole |
| SMILES | OB1OCc2ccc3ccccc3c21 |
| InChI | InChI=1S/C11H9BO2/c13-12-11-9(7-14-12)6-5-8-3-1-2-4-10(8)11/h1-6,13H,7H2 |
| InChIKey | RKVSRXYPRHUVSI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.00 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|