C16H15BO4 — CID 90457849
1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one (PubChem CID 90457849) has the molecular formula C16H15BO4 and a molecular weight of 282.10 g/mol. Its IUPAC name is 1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one.
| Compound Name | 1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 90457849 |
| Molecular Formula | C16H15BO4 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-[(1-hydroxy-7-phenyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
| SMILES | CC(=O)COc1ccc2c(c1-c1ccccc1)B(O)OC2 |
| InChI | InChI=1S/C16H15BO4/c1-11(18)9-20-14-8-7-13-10-21-17(19)16(13)15(14)12-5-3-2-4-6-12/h2-8,19H,9-10H2,1H3 |
| InChIKey | QEALUKJBWCDLDB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|