C12H16BNO4 — CID 90461572
1-[[7-(dimethylamino)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-one (PubChem CID 90461572) has the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. Its IUPAC name is 1-[[7-(dimethylamino)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-one.
| Compound Name | 1-[[7-(dimethylamino)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-one |
|---|---|
| PubChem CID | 90461572 |
| Molecular Formula | C12H16BNO4 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-[[7-(dimethylamino)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-one |
| SMILES | CC(=O)COc1ccc2c(c1N(C)C)B(O)OC2 |
| InChI | InChI=1S/C12H16BNO4/c1-8(15)6-17-10-5-4-9-7-18-13(16)11(9)12(10)14(2)3/h4-5,16H,6-7H2,1-3H3 |
| InChIKey | LTSMVRRWTNWKPU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|