C11H11BO6 — CID 142597370
ethyl 1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborole-7-carboxylate (PubChem CID 142597370) has the molecular formula C11H11BO6 and a molecular weight of 250.01 g/mol. Its IUPAC name is ethyl 1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborole-7-carboxylate.
| Compound Name | ethyl 1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborole-7-carboxylate |
|---|---|
| PubChem CID | 142597370 |
| Molecular Formula | C11H11BO6 |
| Molecular Weight | 250.01 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | ethyl 1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborole-7-carboxylate |
| SMILES | CCOC(=O)C1Oc2ccc3c(c2O1)B(O)OC3 |
| InChI | InChI=1S/C11H11BO6/c1-2-15-10(13)11-17-7-4-3-6-5-16-12(14)8(6)9(7)18-11/h3-4,11,14H,2,5H2,1H3 |
| InChIKey | MRCRFROIAPFNLQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.01 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|