C10H10BNO6 — CID 90461735
1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one (PubChem CID 90461735) has the molecular formula C10H10BNO6 and a molecular weight of 251.00 g/mol. Its IUPAC name is 1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one.
| Compound Name | 1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 90461735 |
| Molecular Formula | C10H10BNO6 |
| Molecular Weight | 251.00 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-[(1-hydroxy-7-nitro-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
| SMILES | CC(=O)COc1ccc2c(c1[N+](=O)[O-])B(O)OC2 |
| InChI | InChI=1S/C10H10BNO6/c1-6(13)4-17-8-3-2-7-5-18-11(14)9(7)10(8)12(15)16/h2-3,14H,4-5H2,1H3 |
| InChIKey | UCXLYFFQHCCCGV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.00 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|