C11H13BO5 — CID 25131741
4-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]butanoic acid (PubChem CID 25131741) has the molecular formula C11H13BO5 and a molecular weight of 236.03 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]butanoic acid.
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 25131741 |
| Molecular Formula | C11H13BO5 |
| Molecular Weight | 236.03 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C11H13BO5/c13-10(14)5-2-6-16-9-4-1-3-8-7-17-12(15)11(8)9/h1,3-4,15H,2,5-7H2,(H,13,14) |
| InChIKey | APCWROSBSLIDOT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.03 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|