C12H16BNO4 — CID 68646385
[7-(3-aminopropoxy)-3H-2,1-benzoxaborol-1-yl] acetate (PubChem CID 68646385) has the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. Its IUPAC name is [7-(3-aminopropoxy)-3H-2,1-benzoxaborol-1-yl] acetate.
| Compound Name | [7-(3-aminopropoxy)-3H-2,1-benzoxaborol-1-yl] acetate |
|---|---|
| PubChem CID | 68646385 |
| Molecular Formula | C12H16BNO4 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [7-(3-aminopropoxy)-3H-2,1-benzoxaborol-1-yl] acetate |
| SMILES | CC(=O)OB1OCc2cccc(OCCCN)c21 |
| InChI | InChI=1S/C12H16BNO4/c1-9(15)18-13-12-10(8-17-13)4-2-5-11(12)16-7-3-6-14/h2,4-5H,3,6-8,14H2,1H3 |
| InChIKey | SDSVHVLLJMKSBG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|