C12H16BNO3 — CID 59582694
1-[[(3S)-3-(aminomethyl)-1-methyl-3H-2,1-benzoxaborol-7-yl]oxy]propan-2-one (PubChem CID 59582694) has the molecular formula C12H16BNO3 and a molecular weight of 233.08 g/mol. Its IUPAC name is 1-[[(3S)-3-(aminomethyl)-1-methyl-3H-2,1-benzoxaborol-7-yl]oxy]propan-2-one.
| Compound Name | 1-[[(3S)-3-(aminomethyl)-1-methyl-3H-2,1-benzoxaborol-7-yl]oxy]propan-2-one |
|---|---|
| PubChem CID | 59582694 |
| Molecular Formula | C12H16BNO3 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-[[(3S)-3-(aminomethyl)-1-methyl-3H-2,1-benzoxaborol-7-yl]oxy]propan-2-one |
| SMILES | CB1O[C@H](CN)c2cccc(OCC(C)=O)c21 |
| InChI | InChI=1S/C12H16BNO3/c1-8(15)7-16-10-5-3-4-9-11(6-14)17-13(2)12(9)10/h3-5,11H,6-7,14H2,1-2H3/t11-/m1/s1 |
| InChIKey | CLOFYDQOKQCUJN-LLVKDONJSA-N |
| XLogP | 0.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|