C11H15BO3 — CID 59515272
[(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-yl]oxymethanol (PubChem CID 59515272) has the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. Its IUPAC name is [(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-yl]oxymethanol.
| Compound Name | [(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-yl]oxymethanol |
|---|---|
| PubChem CID | 59515272 |
| Molecular Formula | C11H15BO3 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(3R)-3-ethyl-1-methyl-3H-2,1-benzoxaborol-7-yl]oxymethanol |
| SMILES | CC[C@H]1OB(C)c2c(OCO)cccc21 |
| InChI | InChI=1S/C11H15BO3/c1-3-9-8-5-4-6-10(14-7-13)11(8)12(2)15-9/h4-6,9,13H,3,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | WDPUCFZBGHBOLP-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|