C11H16BNO4 — CID 53495382
3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propan-1-ol (PubChem CID 53495382) has the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propan-1-ol.
| Compound Name | 3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 53495382 |
| Molecular Formula | C11H16BNO4 |
| Molecular Weight | 237.06 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propan-1-ol |
| SMILES | NCC1OB(O)c2c(OCCCO)cccc21 |
| InChI | InChI=1S/C11H16BNO4/c13-7-10-8-3-1-4-9(16-6-2-5-14)11(8)12(15)17-10/h1,3-4,10,14-15H,2,5-7,13H2 |
| InChIKey | FXQIIDINBDJDKL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.06 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|