C11H17BClNO4 — CID 56944752
(7-ethoxy-1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)methanamine;hydrochloride (PubChem CID 56944752) has the molecular formula C11H17BClNO4 and a molecular weight of 273.52 g/mol. Its IUPAC name is (7-ethoxy-1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)methanamine;hydrochloride.
| Compound Name | (7-ethoxy-1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 56944752 |
| Molecular Formula | C11H17BClNO4 |
| Molecular Weight | 273.52 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (7-ethoxy-1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)methanamine;hydrochloride |
| SMILES | CCOc1c(OC)ccc2c1B(O)OC2CN.Cl |
| InChI | InChI=1S/C11H16BNO4.ClH/c1-3-16-11-8(15-2)5-4-7-9(6-13)17-12(14)10(7)11;/h4-5,9,14H,3,6,13H2,1-2H3;1H |
| InChIKey | RFSIDCVHZSVOJB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.52 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|