C11H16BNO3 — CID 157207276
(1-hydroxy-6-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine (PubChem CID 157207276) has the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. Its IUPAC name is (1-hydroxy-6-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine.
| Compound Name | (1-hydroxy-6-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine |
|---|---|
| PubChem CID | 157207276 |
| Molecular Formula | C11H16BNO3 |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (1-hydroxy-6-propoxy-3H-2,1-benzoxaborol-3-yl)methanamine |
| SMILES | CCCOc1ccc2c(c1)B(O)OC2CN |
| InChI | InChI=1S/C11H16BNO3/c1-2-5-15-8-3-4-9-10(6-8)12(14)16-11(9)7-13/h3-4,6,11,14H,2,5,7,13H2,1H3 |
| InChIKey | ARMPWFRAEWIFIG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|