C25H28BN2O6W- — CID 58277051
1-[2-[6-[[(3S)-3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]hex-1-enyl]-5-carboxy-8-methyl-4-oxo-1-azabicyclo[4.2.0]octa-2,5-dien-3-yl]ethylidenetungsten (PubChem CID 58277051) has the molecular formula C25H28BN2O6W- and a molecular weight of 647.16 g/mol. Its IUPAC name is 1-[2-[6-[[(3S)-3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]hex-1-enyl]-5-carboxy-8-methyl-4-oxo-1-azabicyclo[4.2.0]octa-2,5-dien-3-yl]ethylidenetungsten.
| Compound Name | 1-[2-[6-[[(3S)-3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]hex-1-enyl]-5-carboxy-8-methyl-4-oxo-1-azabicyclo[4.2.0]octa-2,5-dien-3-yl]ethylidenetungsten |
|---|---|
| PubChem CID | 58277051 |
| Molecular Formula | C25H28BN2O6W- |
| Molecular Weight | 647.16 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | 1-[2-[6-[[(3S)-3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]hex-1-enyl]-5-carboxy-8-methyl-4-oxo-1-azabicyclo[4.2.0]octa-2,5-dien-3-yl]ethylidenetungsten |
| SMILES | CC(=[W])c1c(/C=[C-]/CCCCOc2ccc3c(c2)B(O)O[C@@H]3CN)n2c(c(C(=O)O)c1=O)CC2C |
| InChI | InChI=1S/C25H28BN2O6.W/c1-3-17-20(28-15(2)12-21(28)23(24(17)29)25(30)31)8-6-4-5-7-11-33-16-9-10-18-19(13-16)26(32)34-22(18)14-27;/h8-10,13,15,22,32H,4-5,7,11-12,14,27H2,1-2H3,(H,30,31);/q-1;/t15?,22-;/m1./s1 |
| InChIKey | AQEIEVWNRAJMMH-WQZSEIDWSA-N |
| XLogP | 1.53 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|