C25H32BNO8 — CID 59525310
ethyl 2-[(3R)-1-hydroxy-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenoxy]-3H-2,1-benzoxaborol-3-yl]acetate (PubChem CID 59525310) has the molecular formula C25H32BNO8 and a molecular weight of 485.34 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-hydroxy-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenoxy]-3H-2,1-benzoxaborol-3-yl]acetate.
| Compound Name | ethyl 2-[(3R)-1-hydroxy-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenoxy]-3H-2,1-benzoxaborol-3-yl]acetate |
|---|---|
| PubChem CID | 59525310 |
| Molecular Formula | C25H32BNO8 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | ethyl 2-[(3R)-1-hydroxy-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]phenoxy]-3H-2,1-benzoxaborol-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1OB(O)c2cc(Oc3cccc(OCCCNC(=O)OC(C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C25H32BNO8/c1-5-31-23(28)16-22-20-11-10-19(15-21(20)26(30)35-22)33-18-9-6-8-17(14-18)32-13-7-12-27-24(29)34-25(2,3)4/h6,8-11,14-15,22,30H,5,7,12-13,16H2,1-4H3,(H,27,29)/t22-/m1/s1 |
| InChIKey | BQTZPZIDWWZXNE-JOCHJYFZSA-N |
| XLogP | 3.48 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|