C24H31N3O5 — CID 101056284
tert-butyl N-[4-[(2R,3S)-3-[[4-(3-aminophenoxy)phenyl]carbamoyl]oxiran-2-yl]butyl]carbamate (PubChem CID 101056284) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl N-[4-[(2R,3S)-3-[[4-(3-aminophenoxy)phenyl]carbamoyl]oxiran-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2R,3S)-3-[[4-(3-aminophenoxy)phenyl]carbamoyl]oxiran-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 101056284 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl N-[4-[(2R,3S)-3-[[4-(3-aminophenoxy)phenyl]carbamoyl]oxiran-2-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H]1O[C@@H]1C(=O)Nc1ccc(Oc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-24(2,3)32-23(29)26-14-5-4-9-20-21(31-20)22(28)27-17-10-12-18(13-11-17)30-19-8-6-7-16(25)15-19/h6-8,10-13,15,20-21H,4-5,9,14,25H2,1-3H3,(H,26,29)(H,27,28)/t20-,21+/m1/s1 |
| InChIKey | OHMHEVNJGJSMRI-RTWAWAEBSA-N |
| XLogP | 4.46 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|