C18H19BO6 — CID 58292671
ethyl 2-[1-hydroxy-6-(3-hydroxyphenoxy)-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate (PubChem CID 58292671) has the molecular formula C18H19BO6 and a molecular weight of 342.16 g/mol. Its IUPAC name is ethyl 2-[1-hydroxy-6-(3-hydroxyphenoxy)-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate.
| Compound Name | ethyl 2-[1-hydroxy-6-(3-hydroxyphenoxy)-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
|---|---|
| PubChem CID | 58292671 |
| Molecular Formula | C18H19BO6 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | ethyl 2-[1-hydroxy-6-(3-hydroxyphenoxy)-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
| SMILES | CCOC(=O)CC1OB(O)c2cc(Oc3cccc(O)c3)cc(C)c21 |
| InChI | InChI=1S/C18H19BO6/c1-3-23-17(21)10-16-18-11(2)7-14(9-15(18)19(22)25-16)24-13-6-4-5-12(20)8-13/h4-9,16,20,22H,3,10H2,1-2H3 |
| InChIKey | PAKIYCIOAUYOCD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|