C13H17BO6 — CID 58292634
ethyl 2-(1-hydroxy-4,6-dimethoxy-3H-2,1-benzoxaborol-3-yl)acetate (PubChem CID 58292634) has the molecular formula C13H17BO6 and a molecular weight of 280.08 g/mol. Its IUPAC name is ethyl 2-(1-hydroxy-4,6-dimethoxy-3H-2,1-benzoxaborol-3-yl)acetate.
| Compound Name | ethyl 2-(1-hydroxy-4,6-dimethoxy-3H-2,1-benzoxaborol-3-yl)acetate |
|---|---|
| PubChem CID | 58292634 |
| Molecular Formula | C13H17BO6 |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | ethyl 2-(1-hydroxy-4,6-dimethoxy-3H-2,1-benzoxaborol-3-yl)acetate |
| SMILES | CCOC(=O)CC1OB(O)c2cc(OC)cc(OC)c21 |
| InChI | InChI=1S/C13H17BO6/c1-4-19-12(15)7-11-13-9(14(16)20-11)5-8(17-2)6-10(13)18-3/h5-6,11,16H,4,7H2,1-3H3 |
| InChIKey | GKOQQMSLVMGLNP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|