C18H21BN2O5 — CID 58292718
ethyl 2-[6-[[5-(aminomethyl)-2-pyridinyl]oxy]-1-hydroxy-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate (PubChem CID 58292718) has the molecular formula C18H21BN2O5 and a molecular weight of 356.19 g/mol. Its IUPAC name is ethyl 2-[6-[[5-(aminomethyl)-2-pyridinyl]oxy]-1-hydroxy-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate.
| Compound Name | ethyl 2-[6-[[5-(aminomethyl)-2-pyridinyl]oxy]-1-hydroxy-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
|---|---|
| PubChem CID | 58292718 |
| Molecular Formula | C18H21BN2O5 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 2-[6-[[5-(aminomethyl)-2-pyridinyl]oxy]-1-hydroxy-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
| SMILES | CCOC(=O)CC1OB(O)c2cc(Oc3ccc(CN)cn3)cc(C)c21 |
| InChI | InChI=1S/C18H21BN2O5/c1-3-24-17(22)8-15-18-11(2)6-13(7-14(18)19(23)26-15)25-16-5-4-12(9-20)10-21-16/h4-7,10,15,23H,3,8-9,20H2,1-2H3 |
| InChIKey | XBNIXTAISRKRKW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|