C18H17BN2O5 — CID 58292644
ethyl 2-[1-hydroxy-6-[(4-isocyano-2-pyridinyl)oxy]-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate (PubChem CID 58292644) has the molecular formula C18H17BN2O5 and a molecular weight of 352.16 g/mol. Its IUPAC name is ethyl 2-[1-hydroxy-6-[(4-isocyano-2-pyridinyl)oxy]-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate.
| Compound Name | ethyl 2-[1-hydroxy-6-[(4-isocyano-2-pyridinyl)oxy]-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
|---|---|
| PubChem CID | 58292644 |
| Molecular Formula | C18H17BN2O5 |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl 2-[1-hydroxy-6-[(4-isocyano-2-pyridinyl)oxy]-4-methyl-3H-2,1-benzoxaborol-3-yl]acetate |
| SMILES | [C-]#[N+]c1ccnc(Oc2cc(C)c3c(c2)B(O)OC3CC(=O)OCC)c1 |
| InChI | InChI=1S/C18H17BN2O5/c1-4-24-17(22)10-15-18-11(2)7-13(9-14(18)19(23)26-15)25-16-8-12(20-3)5-6-21-16/h5-9,15,23H,4,10H2,1-2H3 |
| InChIKey | SPUSXJZXRICLHC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|