C17H18BNO6 — CID 67252675
ethyl 2-[1-hydroxy-4-methyl-6-(1-oxidopyridin-1-ium-2-yl)oxy-3H-2,1-benzoxaborol-3-yl]acetate (PubChem CID 67252675) has the molecular formula C17H18BNO6 and a molecular weight of 343.14 g/mol. Its IUPAC name is ethyl 2-[1-hydroxy-4-methyl-6-(1-oxidopyridin-1-ium-2-yl)oxy-3H-2,1-benzoxaborol-3-yl]acetate.
| Compound Name | ethyl 2-[1-hydroxy-4-methyl-6-(1-oxidopyridin-1-ium-2-yl)oxy-3H-2,1-benzoxaborol-3-yl]acetate |
|---|---|
| PubChem CID | 67252675 |
| Molecular Formula | C17H18BNO6 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | ethyl 2-[1-hydroxy-4-methyl-6-(1-oxidopyridin-1-ium-2-yl)oxy-3H-2,1-benzoxaborol-3-yl]acetate |
| SMILES | CCOC(=O)CC1OB(O)c2cc(Oc3cccc[n+]3[O-])cc(C)c21 |
| InChI | InChI=1S/C17H18BNO6/c1-3-23-16(20)10-14-17-11(2)8-12(9-13(17)18(21)25-14)24-15-6-4-5-7-19(15)22/h4-9,14,21H,3,10H2,1-2H3 |
| InChIKey | IYRBZISJCACURF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|