C13H20BNO6 — CID 68646142
acetic acid;1-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-ol (PubChem CID 68646142) has the molecular formula C13H20BNO6 and a molecular weight of 297.12 g/mol. Its IUPAC name is acetic acid;1-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-ol.
| Compound Name | acetic acid;1-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 68646142 |
| Molecular Formula | C13H20BNO6 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | acetic acid;1-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]oxy]propan-2-ol |
| SMILES | CC(=O)O.CC(O)COc1ccc2c(c1)B(O)OC2CN |
| InChI | InChI=1S/C11H16BNO4.C2H4O2/c1-7(14)6-16-8-2-3-9-10(4-8)12(15)17-11(9)5-13;1-2(3)4/h2-4,7,11,14-15H,5-6,13H2,1H3;1H3,(H,3,4) |
| InChIKey | MSHBUBXBLOBBGA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|