C12H16BNO5 — CID 68646340
[3-(aminomethyl)-6-(2-hydroxyethoxy)-3H-2,1-benzoxaborol-1-yl] acetate (PubChem CID 68646340) has the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. Its IUPAC name is [3-(aminomethyl)-6-(2-hydroxyethoxy)-3H-2,1-benzoxaborol-1-yl] acetate.
| Compound Name | [3-(aminomethyl)-6-(2-hydroxyethoxy)-3H-2,1-benzoxaborol-1-yl] acetate |
|---|---|
| PubChem CID | 68646340 |
| Molecular Formula | C12H16BNO5 |
| Molecular Weight | 265.07 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [3-(aminomethyl)-6-(2-hydroxyethoxy)-3H-2,1-benzoxaborol-1-yl] acetate |
| SMILES | CC(=O)OB1OC(CN)c2ccc(OCCO)cc21 |
| InChI | InChI=1S/C12H16BNO5/c1-8(16)18-13-11-6-9(17-5-4-15)2-3-10(11)12(7-14)19-13/h2-3,6,12,15H,4-5,7,14H2,1H3 |
| InChIKey | WAFDZVNPBKQMGJ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.07 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|