C12H15BO5 — CID 70956013
methyl 3-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)propanoate (PubChem CID 70956013) has the molecular formula C12H15BO5 and a molecular weight of 250.06 g/mol. Its IUPAC name is methyl 3-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)propanoate.
| Compound Name | methyl 3-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)propanoate |
|---|---|
| PubChem CID | 70956013 |
| Molecular Formula | C12H15BO5 |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl 3-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)propanoate |
| SMILES | COC(=O)CCC1OB(O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C12H15BO5/c1-16-8-3-4-9-10(7-8)13(15)18-11(9)5-6-12(14)17-2/h3-4,7,11,15H,5-6H2,1-2H3 |
| InChIKey | UIYGMRXBPIECAT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|