C10H11BO5 — CID 59525332
2-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)acetic acid (PubChem CID 59525332) has the molecular formula C10H11BO5 and a molecular weight of 222.00 g/mol. Its IUPAC name is 2-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)acetic acid.
| Compound Name | 2-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)acetic acid |
|---|---|
| PubChem CID | 59525332 |
| Molecular Formula | C10H11BO5 |
| Molecular Weight | 222.00 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-(1-hydroxy-6-methoxy-3H-2,1-benzoxaborol-3-yl)acetic acid |
| SMILES | COc1ccc2c(c1)B(O)OC2CC(=O)O |
| InChI | InChI=1S/C10H11BO5/c1-15-6-2-3-7-8(4-6)11(14)16-9(7)5-10(12)13/h2-4,9,14H,5H2,1H3,(H,12,13) |
| InChIKey | WCANCMZTXAQTJR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.00 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|